C10H12N5O6PS2 — CID 136677721
[2-amino-4-oxo-6,7-bis(sulfanyl)-3,5,8,10-tetrahydropyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate (PubChem CID 136677721) has the molecular formula C10H12N5O6PS2 and a molecular weight of 393.34 g/mol. Its IUPAC name is [2-amino-4-oxo-6,7-bis(sulfanyl)-3,5,8,10-tetrahydropyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-4-oxo-6,7-bis(sulfanyl)-3,5,8,10-tetrahydropyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 136677721 |
| Molecular Formula | C10H12N5O6PS2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | [2-amino-4-oxo-6,7-bis(sulfanyl)-3,5,8,10-tetrahydropyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate |
| SMILES | Nc1nc2c(c(=O)[nH]1)NC1=C(N2)OC(COP(=O)(O)O)C(S)=C1S |
| InChI | InChI=1S/C10H12N5O6PS2/c11-10-14-7-4(8(16)15-10)12-3-6(24)5(23)2(21-9(3)13-7)1-20-22(17,18)19/h2,12,23-24H,1H2,(H2,17,18,19)(H4,11,13,14,15,16) |
| InChIKey | MDCODBKNMNJFFI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|