C5H7N5O2 — CID 136740661
(8S)-2-amino-8-hydroxy-1,7,8,9-tetrahydropurin-6-one (PubChem CID 136740661) has the molecular formula C5H7N5O2 and a molecular weight of 169.14 g/mol. Its IUPAC name is (8S)-2-amino-8-hydroxy-1,7,8,9-tetrahydropurin-6-one.
| Compound Name | (8S)-2-amino-8-hydroxy-1,7,8,9-tetrahydropurin-6-one |
|---|---|
| PubChem CID | 136740661 |
| Molecular Formula | C5H7N5O2 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (8S)-2-amino-8-hydroxy-1,7,8,9-tetrahydropurin-6-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)N[C@H](O)N2 |
| InChI | InChI=1S/C5H7N5O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2/h5,7,12H,(H4,6,8,9,10,11)/t5-/m0/s1 |
| InChIKey | PQCYNJFGLQGFKP-YFKPBYRVSA-N |
| XLogP | -1.53 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |