C9H15N6O3 — CID 136880491
CID 136880491 (PubChem CID 136880491) has the molecular formula C9H15N6O3 and a molecular weight of 255.26 g/mol.
| Compound Name | CID 136880491 |
|---|---|
| PubChem CID | 136880491 |
| Molecular Formula | C9H15N6O3 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N([O])N1c2c(nc(N)[nH]c2=O)NC1O |
| InChI | InChI=1S/C9H15N6O3/c1-9(2,3)15(18)14-4-5(12-8(14)17)11-7(10)13-6(4)16/h8,17H,1-3H3,(H4,10,11,12,13,16) |
| InChIKey | OASYDTMHSJOETL-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|