C10H12N5O6PS2-2 — CID 135566184
(5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate (PubChem CID 135566184) has the molecular formula C10H12N5O6PS2-2 and a molecular weight of 393.34 g/mol. Its IUPAC name is (5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate.
| Compound Name | (5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate |
|---|---|
| PubChem CID | 135566184 |
| Molecular Formula | C10H12N5O6PS2-2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | (5aR,8R,9aR)-2-amino-4-oxo-8-(phosphonooxymethyl)-3,5,5a,8,9a,10-hexahydropyrano[3,2-g]pteridine-6,7-dithiolate |
| SMILES | Nc1nc2c(c(=O)[nH]1)N[C@H]1C([S-])=C([S-])[C@@H](COP(=O)(O)O)O[C@H]1N2 |
| InChI | InChI=1S/C10H14N5O6PS2/c11-10-14-7-4(8(16)15-10)12-3-6(24)5(23)2(21-9(3)13-7)1-20-22(17,18)19/h2-3,9,12,23-24H,1H2,(H2,17,18,19)(H4,11,13,14,15,16)/p-2/t2-,3+,9-/m1/s1 |
| InChIKey | HPEUEJRPDGMIMY-IFQPEPLCSA-L |
| XLogP | -1.30 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|