C10H11N5O2 — CID 135409237
3-[2-[(2-hydroxyphenyl)methyl]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135409237) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-[2-[(2-hydroxyphenyl)methyl]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[2-[(2-hydroxyphenyl)methyl]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135409237 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[2-[(2-hydroxyphenyl)methyl]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1cnnc(NNCc2ccccc2O)[nH]1 |
| InChI | InChI=1S/C10H11N5O2/c16-8-4-2-1-3-7(8)5-11-14-10-13-9(17)6-12-15-10/h1-4,6,11,16H,5H2,(H2,13,14,15,17) |
| InChIKey | CNFLPKPNWZOJET-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|