C12H15N5O3 — CID 150722985
2-[[2-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydrazinyl]methyl]phenol (PubChem CID 150722985) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[[2-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydrazinyl]methyl]phenol.
| Compound Name | 2-[[2-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydrazinyl]methyl]phenol |
|---|---|
| PubChem CID | 150722985 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[[2-(4,6-dimethoxy-1,3,5-triazin-2-yl)hydrazinyl]methyl]phenol |
| SMILES | COc1nc(NNCc2ccccc2O)nc(OC)n1 |
| InChI | InChI=1S/C12H15N5O3/c1-19-11-14-10(15-12(16-11)20-2)17-13-7-8-5-3-4-6-9(8)18/h3-6,13,18H,7H2,1-2H3,(H,14,15,16,17) |
| InChIKey | JQFXRXUKJBPKCS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|