C20H18N2O3 — CID 135412904
15-[2-(dimethylamino)ethyl]-14-hydroxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,16-dione (PubChem CID 135412904) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 15-[2-(dimethylamino)ethyl]-14-hydroxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,16-dione.
| Compound Name | 15-[2-(dimethylamino)ethyl]-14-hydroxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,16-dione |
|---|---|
| PubChem CID | 135412904 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 15-[2-(dimethylamino)ethyl]-14-hydroxy-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13-heptaene-8,16-dione |
| SMILES | CN(C)CCn1c(O)c2cccc3c2c(c1=O)-c1ccccc1C3=O |
| InChI | InChI=1S/C20H18N2O3/c1-21(2)10-11-22-19(24)15-9-5-8-14-16(15)17(20(22)25)12-6-3-4-7-13(12)18(14)23/h3-9,24H,10-11H2,1-2H3 |
| InChIKey | JXZDIKDWMRGFMK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |