C16H16N4O6S — CID 135413716
3-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-nitrobenzoic acid (PubChem CID 135413716) has the molecular formula C16H16N4O6S and a molecular weight of 392.39 g/mol. Its IUPAC name is 3-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-nitrobenzoic acid.
| Compound Name | 3-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 135413716 |
| Molecular Formula | C16H16N4O6S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-[[2-[(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]-5-nitrobenzoic acid |
| SMILES | CCc1c(C)nc(SCC(=O)Nc2cc(C(=O)O)cc([N+](=O)[O-])c2)[nH]c1=O |
| InChI | InChI=1S/C16H16N4O6S/c1-3-12-8(2)17-16(19-14(12)22)27-7-13(21)18-10-4-9(15(23)24)5-11(6-10)20(25)26/h4-6H,3,7H2,1-2H3,(H,18,21)(H,23,24)(H,17,19,22) |
| InChIKey | AKBQJOLPHXDXRM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 155.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|