C15H17F3N4O5S — CID 135415864
(3S,4R)-2,2-dimethyl-4-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]-6-(trifluoromethoxy)-3,4-dihydrochromen-3-ol (PubChem CID 135415864) has the molecular formula C15H17F3N4O5S and a molecular weight of 422.39 g/mol. Its IUPAC name is (3S,4R)-2,2-dimethyl-4-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]-6-(trifluoromethoxy)-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-2,2-dimethyl-4-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]-6-(trifluoromethoxy)-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 135415864 |
| Molecular Formula | C15H17F3N4O5S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (3S,4R)-2,2-dimethyl-4-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]-6-(trifluoromethoxy)-3,4-dihydrochromen-3-ol |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N/[C@@H]1c2cc(OC(F)(F)F)ccc2OC(C)(C)[C@H]1O |
| InChI | InChI=1S/C15H17F3N4O5S/c1-14(2)11(23)10(20-13-12(19-3)21-28(24,25)22-13)8-6-7(26-15(16,17)18)4-5-9(8)27-14/h4-6,10-11,23H,1-3H3,(H,19,21)(H,20,22)/t10-,11+/m1/s1 |
| InChIKey | WWUJLTVPGJZXRT-MNOVXSKESA-N |
| XLogP | 1.02 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|