C17H24F3NO5S — CID 162546193
N-[(3S,4S)-3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]-N-methylmethanesulfonamide (PubChem CID 162546193) has the molecular formula C17H24F3NO5S and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[(3S,4S)-3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[(3S,4S)-3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 162546193 |
| Molecular Formula | C17H24F3NO5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[(3S,4S)-3-hydroxy-2,2-dimethyl-6-(4,4,4-trifluorobutoxy)-3,4-dihydrochromen-4-yl]-N-methylmethanesulfonamide |
| SMILES | CN([C@H]1c2cc(OCCCC(F)(F)F)ccc2OC(C)(C)[C@H]1O)S(C)(=O)=O |
| InChI | InChI=1S/C17H24F3NO5S/c1-16(2)15(22)14(21(3)27(4,23)24)12-10-11(6-7-13(12)26-16)25-9-5-8-17(18,19)20/h6-7,10,14-15,22H,5,8-9H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | SRZRLJWUQFIZRH-GJZGRUSLSA-N |
| XLogP | 2.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|