C11H10N4S — CID 135416170
8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 135416170) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is 8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 135416170 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 8-ethyl-2,5-dihydro-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | CCc1ccc2[nH]c3nc(=S)[nH]nc3c2c1 |
| InChI | InChI=1S/C11H10N4S/c1-2-6-3-4-8-7(5-6)9-10(12-8)13-11(16)15-14-9/h3-5H,2H2,1H3,(H2,12,13,15,16) |
| InChIKey | IGWALTZGBYKKEF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|