C24H21ClN2O6 — CID 135416422
N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]-3,4,5-trimethoxybenzamide (PubChem CID 135416422) has the molecular formula C24H21ClN2O6 and a molecular weight of 468.89 g/mol. Its IUPAC name is N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135416422 |
| Molecular Formula | C24H21ClN2O6 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxy-5-methylphenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(C)c(O)c(-c3nc4cc(Cl)ccc4o3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H21ClN2O6/c1-12-7-15(26-23(29)13-8-19(30-2)22(32-4)20(9-13)31-3)11-16(21(12)28)24-27-17-10-14(25)5-6-18(17)33-24/h5-11,28H,1-4H3,(H,26,29) |
| InChIKey | LBBPHRRPMCGVJF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|