C22H23ClN4O2 — CID 135417697
3-(2-chlorophenyl)-1-cyclohexyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]urea (PubChem CID 135417697) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-cyclohexyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]urea.
| Compound Name | 3-(2-chlorophenyl)-1-cyclohexyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 135417697 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 3-(2-chlorophenyl)-1-cyclohexyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]urea |
| SMILES | O=C(Nc1ccccc1Cl)N(Cc1nc2ccccc2c(=O)[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C22H23ClN4O2/c23-17-11-5-7-13-19(17)25-22(29)27(15-8-2-1-3-9-15)14-20-24-18-12-6-4-10-16(18)21(28)26-20/h4-7,10-13,15H,1-3,8-9,14H2,(H,25,29)(H,24,26,28) |
| InChIKey | PSDXCHRRNJYKNO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |