C18H23N5O2 — CID 135419269
6-[5-(dimethylamino)-2-propoxyphenyl]-1,3-dimethyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135419269) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 6-[5-(dimethylamino)-2-propoxyphenyl]-1,3-dimethyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[5-(dimethylamino)-2-propoxyphenyl]-1,3-dimethyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135419269 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 6-[5-(dimethylamino)-2-propoxyphenyl]-1,3-dimethyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCOc1ccc(N(C)C)cc1-c1nc2c(c(C)nn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C18H23N5O2/c1-6-9-25-14-8-7-12(22(3)4)10-13(14)16-19-17-15(18(24)20-16)11(2)21-23(17)5/h7-8,10H,6,9H2,1-5H3,(H,19,20,24) |
| InChIKey | DPLCFJGPNXCCRN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|