C16H17N5O4 — CID 135536783
1,3-dimethyl-6-(5-nitro-2-propoxyphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135536783) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 1,3-dimethyl-6-(5-nitro-2-propoxyphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1,3-dimethyl-6-(5-nitro-2-propoxyphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135536783 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1,3-dimethyl-6-(5-nitro-2-propoxyphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCOc1ccc([N+](=O)[O-])cc1-c1nc2c(c(C)nn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C16H17N5O4/c1-4-7-25-12-6-5-10(21(23)24)8-11(12)14-17-15-13(16(22)18-14)9(2)19-20(15)3/h5-6,8H,4,7H2,1-3H3,(H,17,18,22) |
| InChIKey | JKSKMEXKYFYHOV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|