About 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one
3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135503803) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135503803 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCOc1ccccc1-c1nc2c(c(C)nn2CCC)c(=O)[nH]1 |
| InChI | InChI=1S/C18H22N4O2/c1-4-10-22-17-15(12(3)21-22)18(23)20-16(19-17)13-8-6-7-9-14(13)24-11-5-2/h6-9H,4-5,10-11H2,1-3H3,(H,19,20,23) |
| InChIKey | BALGSLLJFIYKHS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 135503803) is 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is CCCOc1ccccc1-c1nc2c(c(C)nn2CCC)c(=O)[nH]1.
What is the InChIKey of 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is BALGSLLJFIYKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-4-10-22-17-15(12(3)21-22)18(23)20-16(19-17)13-8-6-7-9-14(13)24-11-5-2/h6-9H,4-5,10-11H2,1-3H3,(H,19,20,23).
What are the key properties of 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 326.40 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(2-propoxyphenyl)-1-propyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135503803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).