C15H12Br3N3O2 — CID 135420016
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide (PubChem CID 135420016) has the molecular formula C15H12Br3N3O2 and a molecular weight of 505.99 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide |
|---|---|
| PubChem CID | 135420016 |
| Molecular Formula | C15H12Br3N3O2 |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 502.85 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide |
| SMILES | O=C(CNc1cc(Br)c(Br)cc1Br)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C15H12Br3N3O2/c16-10-5-12(18)13(6-11(10)17)19-8-15(23)21-20-7-9-3-1-2-4-14(9)22/h1-7,19,22H,8H2,(H,21,23)/b20-7+ |
| InChIKey | DDVDZIRQIVRVOJ-IFRROFPPSA-N |
| XLogP | 4.24 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|