C15H11Br3N4O3 — CID 5015504
N-[(4-nitrophenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide (PubChem CID 5015504) has the molecular formula C15H11Br3N4O3 and a molecular weight of 534.99 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide.
| Compound Name | N-[(4-nitrophenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide |
|---|---|
| PubChem CID | 5015504 |
| Molecular Formula | C15H11Br3N4O3 |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 531.84 |
| IUPAC Name | N-[(4-nitrophenyl)methylideneamino]-2-(2,4,5-tribromoanilino)acetamide |
| SMILES | O=C(CNc1cc(Br)c(Br)cc1Br)NN=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11Br3N4O3/c16-11-5-13(18)14(6-12(11)17)19-8-15(23)21-20-7-9-1-3-10(4-2-9)22(24)25/h1-7,19H,8H2,(H,21,23) |
| InChIKey | MXUXPPMEQDEEAP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|