C25H24N4O3 — CID 135423108
4-hydroxy-3-[(E)-2-[(2R)-1-[4-(6-oxo-1H-pyridin-3-yl)benzoyl]pyrrolidin-2-yl]ethenyl]benzenecarboximidamide (PubChem CID 135423108) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-2-[(2R)-1-[4-(6-oxo-1H-pyridin-3-yl)benzoyl]pyrrolidin-2-yl]ethenyl]benzenecarboximidamide.
| Compound Name | 4-hydroxy-3-[(E)-2-[(2R)-1-[4-(6-oxo-1H-pyridin-3-yl)benzoyl]pyrrolidin-2-yl]ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 135423108 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-hydroxy-3-[(E)-2-[(2R)-1-[4-(6-oxo-1H-pyridin-3-yl)benzoyl]pyrrolidin-2-yl]ethenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(/C=C/[C@H]2CCCN2C(=O)c2ccc(-c3ccc(=O)[nH]c3)cc2)c1 |
| InChI | InChI=1S/C25H24N4O3/c26-24(27)19-8-11-22(30)18(14-19)7-10-21-2-1-13-29(21)25(32)17-5-3-16(4-6-17)20-9-12-23(31)28-15-20/h3-12,14-15,21,30H,1-2,13H2,(H3,26,27)(H,28,31)/b10-7+/t21-/m1/s1 |
| InChIKey | HAOGHGAXAUGNQA-TYOLEZHBSA-N |
| XLogP | 3.35 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|