C12H11ClN4O4S — CID 135426663
1-(3-chlorophenyl)-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfonyl]urea (PubChem CID 135426663) has the molecular formula C12H11ClN4O4S and a molecular weight of 342.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfonyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfonyl]urea |
|---|---|
| PubChem CID | 135426663 |
| Molecular Formula | C12H11ClN4O4S |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfonyl]urea |
| SMILES | Cc1cc(=O)[nH]c(S(=O)(=O)NC(=O)Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H11ClN4O4S/c1-7-5-10(18)16-12(14-7)22(20,21)17-11(19)15-9-4-2-3-8(13)6-9/h2-6H,1H3,(H,14,16,18)(H2,15,17,19) |
| InChIKey | DTQNXDZXJCLOSE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |