C13H12FNO2 — CID 135427608
2-[(2-fluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 135427608) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(2-fluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135427608 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-[(2-fluorophenyl)iminomethyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CCCC(O)=C1/C=N/c1ccccc1F |
| InChI | InChI=1S/C13H12FNO2/c14-10-4-1-2-5-11(10)15-8-9-12(16)6-3-7-13(9)17/h1-2,4-5,8,16H,3,6-7H2/b15-8+ |
| InChIKey | UAXSAINTPJCIHF-OVCLIPMQSA-N |
| XLogP | 3.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|