C8H10N2O2S — CID 135406836
(2-hydroxy-6-oxocyclohexen-1-yl)methylidenethiourea (PubChem CID 135406836) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is (2-hydroxy-6-oxocyclohexen-1-yl)methylidenethiourea.
| Compound Name | (2-hydroxy-6-oxocyclohexen-1-yl)methylidenethiourea |
|---|---|
| PubChem CID | 135406836 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (2-hydroxy-6-oxocyclohexen-1-yl)methylidenethiourea |
| SMILES | NC(=S)N=CC1=C(O)CCCC1=O |
| InChI | InChI=1S/C8H10N2O2S/c9-8(13)10-4-5-6(11)2-1-3-7(5)12/h4,11H,1-3H2,(H2,9,13) |
| InChIKey | AEKYLUIYQHHUHL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|