C12H15NO6 — CID 135798260
2-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]pentanedioic acid (PubChem CID 135798260) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]pentanedioic acid.
| Compound Name | 2-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]pentanedioic acid |
|---|---|
| PubChem CID | 135798260 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-[(2-hydroxy-6-oxocyclohexen-1-yl)methylideneamino]pentanedioic acid |
| SMILES | O=C(O)CCC(/N=C/C1=C(O)CCCC1=O)C(=O)O |
| InChI | InChI=1S/C12H15NO6/c14-9-2-1-3-10(15)7(9)6-13-8(12(18)19)4-5-11(16)17/h6,8,14H,1-5H2,(H,16,17)(H,18,19)/b13-6+ |
| InChIKey | XHUPNEMFYDZGPD-AWNIVKPZSA-N |
| XLogP | 0.94 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|