C14H15NO4 — CID 122707294
2-[[(Z)-3-phenylprop-2-enylidene]amino]pentanedioic acid (PubChem CID 122707294) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[[(Z)-3-phenylprop-2-enylidene]amino]pentanedioic acid.
| Compound Name | 2-[[(Z)-3-phenylprop-2-enylidene]amino]pentanedioic acid |
|---|---|
| PubChem CID | 122707294 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[[(Z)-3-phenylprop-2-enylidene]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(/N=C/C=C\c1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H15NO4/c16-13(17)9-8-12(14(18)19)15-10-4-7-11-5-2-1-3-6-11/h1-7,10,12H,8-9H2,(H,16,17)(H,18,19)/b7-4-,15-10+ |
| InChIKey | XSWMQMJUTHVILQ-NNGUFLQMSA-N |
| XLogP | 2.09 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|