C15H20N4O2 — CID 154205490
(2S)-2-(cinnamylideneamino)-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 154205490) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2S)-2-(cinnamylideneamino)-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-(cinnamylideneamino)-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 154205490 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (2S)-2-(cinnamylideneamino)-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](/N=C/C=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H20N4O2/c16-15(17)19-11-5-9-13(14(20)21)18-10-4-8-12-6-2-1-3-7-12/h1-4,6-8,10,13H,5,9,11H2,(H,20,21)(H4,16,17,19)/b8-4?,18-10+/t13-/m0/s1 |
| InChIKey | NAJYDXSWMXFMJB-WTMZPWEXSA-N |
| XLogP | 1.28 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|