C15H22N4O3 — CID 175582970
2-amino-5-(diaminomethylideneamino)pentanoic acid;3-phenylprop-2-enal (PubChem CID 175582970) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;3-phenylprop-2-enal.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;3-phenylprop-2-enal |
|---|---|
| PubChem CID | 175582970 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;3-phenylprop-2-enal |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=CC=Cc1ccccc1 |
| InChI | InChI=1S/C9H8O.C6H14N4O2/c10-8-4-7-9-5-2-1-3-6-9;7-4(5(11)12)2-1-3-10-6(8)9/h1-8H;4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | QDIXWGMCIQMQBJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|