C15H22N4O5 — CID 67565131
2-amino-5-(diaminomethylideneamino)pentanoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 67565131) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 67565131 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C9H8O3.C6H14N4O2/c10-8-4-1-7(2-5-8)3-6-9(11)12;7-4(5(11)12)2-1-3-10-6(8)9/h1-6,10H,(H,11,12);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/b6-3+; |
| InChIKey | KUKSAYUMNKWIAW-ZIKNSQGESA-N |
| XLogP | -0.06 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|