C14H20N6O3 — CID 136898758
(2S)-2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 136898758) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2S)-2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 136898758 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2S)-2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(/C=N/[C@@H](CCCN=C(N)N)C(=O)O)c(O)c1 |
| InChI | InChI=1S/C14H20N6O3/c15-12(16)8-3-4-9(11(21)6-8)7-20-10(13(22)23)2-1-5-19-14(17)18/h3-4,6-7,10,21H,1-2,5H2,(H3,15,16)(H,22,23)(H4,17,18,19)/b20-7+/t10-/m0/s1 |
| InChIKey | YFXOJKPEKYMXRA-CUFAKQEUSA-N |
| XLogP | -0.40 |
| TPSA | 184.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|