C20H21LiN4O8 — CID 136802759
lithium 4-[[4-[[amino-[(2,4,6-trihydroxyphenyl)methylideneamino]methylidene]amino]-1-carboxybutyl]iminomethyl]-3,5-dihydroxyphenolate (PubChem CID 136802759) has the molecular formula C20H21LiN4O8 and a molecular weight of 452.35 g/mol. Its IUPAC name is lithium 4-[[4-[[amino-[(2,4,6-trihydroxyphenyl)methylideneamino]methylidene]amino]-1-carboxybutyl]iminomethyl]-3,5-dihydroxyphenolate.
| Compound Name | lithium 4-[[4-[[amino-[(2,4,6-trihydroxyphenyl)methylideneamino]methylidene]amino]-1-carboxybutyl]iminomethyl]-3,5-dihydroxyphenolate |
|---|---|
| PubChem CID | 136802759 |
| Molecular Formula | C20H21LiN4O8 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | lithium 4-[[4-[[amino-[(2,4,6-trihydroxyphenyl)methylideneamino]methylidene]amino]-1-carboxybutyl]iminomethyl]-3,5-dihydroxyphenolate |
| SMILES | N/C(N=Cc1c(O)cc(O)cc1O)=N\CCCC(/N=C/c1c(O)cc([O-])cc1O)C(=O)O.[Li+] |
| InChI | InChI=1S/C20H22N4O8.Li/c21-20(24-9-13-17(29)6-11(26)7-18(13)30)22-3-1-2-14(19(31)32)23-8-12-15(27)4-10(25)5-16(12)28;/h4-9,14,25-30H,1-3H2,(H2,21,22)(H,31,32);/q;+1/p-1/b23-8+,24-9?; |
| InChIKey | FAWPOYFBEZJFKM-JVWRQLMSSA-M |
| XLogP | -2.62 |
| TPSA | 224.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|