C20H20N4O3 — CID 137124034
2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-4-(1H-indol-3-yl)butanoic acid (PubChem CID 137124034) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 137124034 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[(4-carbamimidoyl-2-hydroxyphenyl)methylideneamino]-4-(1H-indol-3-yl)butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(/C=N/C(CCc2c[nH]c3ccccc23)C(=O)O)c(O)c1 |
| InChI | InChI=1S/C20H20N4O3/c21-19(22)12-5-6-14(18(25)9-12)11-24-17(20(26)27)8-7-13-10-23-16-4-2-1-3-15(13)16/h1-6,9-11,17,23,25H,7-8H2,(H3,21,22)(H,26,27)/b24-11+ |
| InChIKey | IRJAPOBIQWYRQC-BHGWPJFGSA-N |
| XLogP | 2.66 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|