C12H15N3O7 — CID 135931820
(2R)-2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]pentanedioic acid (PubChem CID 135931820) has the molecular formula C12H15N3O7 and a molecular weight of 313.27 g/mol. Its IUPAC name is (2R)-2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]pentanedioic acid.
| Compound Name | (2R)-2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]pentanedioic acid |
|---|---|
| PubChem CID | 135931820 |
| Molecular Formula | C12H15N3O7 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2R)-2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylideneamino]pentanedioic acid |
| SMILES | Cn1c(O)c(/C=N/[C@H](CCC(=O)O)C(=O)O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H15N3O7/c1-14-9(18)6(10(19)15(2)12(14)22)5-13-7(11(20)21)3-4-8(16)17/h5,7,18H,3-4H2,1-2H3,(H,16,17)(H,20,21)/b13-5+/t7-/m1/s1 |
| InChIKey | OSTROAQGKGTELF-MOLHFAFQSA-N |
| XLogP | -1.47 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|