C29H24BrN5O5 — CID 135432499
2-[(E)-[1-(4-bromo-2-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 135432499) has the molecular formula C29H24BrN5O5 and a molecular weight of 602.45 g/mol. Its IUPAC name is 2-[(E)-[1-(4-bromo-2-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[(E)-[1-(4-bromo-2-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 135432499 |
| Molecular Formula | C29H24BrN5O5 |
| Molecular Weight | 602.45 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | 2-[(E)-[1-(4-bromo-2-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc(Br)ccc1-n1c(O)c(/C=N/N2C(=O)c3cccc4c(N5CCCCC5)ccc(c34)C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H24BrN5O5/c1-16-14-17(30)8-10-22(16)34-26(37)21(25(36)32-29(34)40)15-31-35-27(38)19-7-5-6-18-23(33-12-3-2-4-13-33)11-9-20(24(18)19)28(35)39/h5-11,14-15,37H,2-4,12-13H2,1H3,(H,32,36,40)/b31-15+ |
| InChIKey | HAHKVTCLYZDJDD-IBBHUPRXSA-N |
| XLogP | 4.08 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|