C27H20N4O5 — CID 4022001
6-[[1-(2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 4022001) has the molecular formula C27H20N4O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is 6-[[1-(2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-[[1-(2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 4022001 |
| Molecular Formula | C27H20N4O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 6-[[1-(2,3-dimethylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | Cc1cccc(-n2c(O)c(C=NN3C(=O)c4ccc5c6c(ccc(c46)C3=O)CC5)c(=O)[nH]c2=O)c1C |
| InChI | InChI=1S/C27H20N4O5/c1-13-4-3-5-20(14(13)2)30-24(33)19(23(32)29-27(30)36)12-28-31-25(34)17-10-8-15-6-7-16-9-11-18(26(31)35)22(17)21(15)16/h3-5,8-12,33H,6-7H2,1-2H3,(H,29,32,36) |
| InChIKey | HLTFOSBMHZWTNM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|