C24H15BrN4O5 — CID 135481377
6-bromo-2-[(E)-[6-hydroxy-1-(3-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione (PubChem CID 135481377) has the molecular formula C24H15BrN4O5 and a molecular weight of 519.31 g/mol. Its IUPAC name is 6-bromo-2-[(E)-[6-hydroxy-1-(3-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-[(E)-[6-hydroxy-1-(3-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 135481377 |
| Molecular Formula | C24H15BrN4O5 |
| Molecular Weight | 519.31 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 6-bromo-2-[(E)-[6-hydroxy-1-(3-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cccc(-n2c(O)c(/C=N/N3C(=O)c4cccc5c(Br)ccc(c45)C3=O)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C24H15BrN4O5/c1-12-4-2-5-13(10-12)28-21(31)17(20(30)27-24(28)34)11-26-29-22(32)15-7-3-6-14-18(25)9-8-16(19(14)15)23(29)33/h2-11,31H,1H3,(H,27,30,34)/b26-11+ |
| InChIKey | VQDAUUWIUHSMDZ-KBKYJPHKSA-N |
| XLogP | 3.09 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|