C21H13BrN4O4 — CID 135698840
5-[(E)-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 135698840) has the molecular formula C21H13BrN4O4 and a molecular weight of 465.26 g/mol. Its IUPAC name is 5-[(E)-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(E)-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135698840 |
| Molecular Formula | C21H13BrN4O4 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | 5-[(E)-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/N2C(=O)c3cccc4c(Br)ccc(c34)C2=O)c(O)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C21H13BrN4O4/c1-10-14(8-23)18(27)25(2)19(28)15(10)9-24-26-20(29)12-5-3-4-11-16(22)7-6-13(17(11)12)21(26)30/h3-7,9,28H,1-2H3/b24-9+ |
| InChIKey | SLNCZDVXBPKLOH-PGGKNCGUSA-N |
| XLogP | 2.82 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|