C20H12N4O5 — CID 135589288
6-hydroxy-5-[(E)-(5-hydroxy-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-4-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 135589288) has the molecular formula C20H12N4O5 and a molecular weight of 388.34 g/mol. Its IUPAC name is 6-hydroxy-5-[(E)-(5-hydroxy-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-4-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-5-[(E)-(5-hydroxy-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-4-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135589288 |
| Molecular Formula | C20H12N4O5 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 6-hydroxy-5-[(E)-(5-hydroxy-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]-4-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/N2C(=O)c3cccc4cc(O)cc(c34)C2=O)c(O)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C20H12N4O5/c1-9-14(7-21)17(26)23-18(27)15(9)8-22-24-19(28)12-4-2-3-10-5-11(25)6-13(16(10)12)20(24)29/h2-6,8,25H,1H3,(H2,23,26,27)/b22-8+ |
| InChIKey | VIYQWQXSJSYYMO-GZIVZEMBSA-N |
| XLogP | 1.75 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|