C15H11F3N2O4 — CID 135433589
4-hydroxy-3-[(E)-[[2-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 135433589) has the molecular formula C15H11F3N2O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-[[2-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-hydroxy-3-[(E)-[[2-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 135433589 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-hydroxy-3-[(E)-[[2-(trifluoromethoxy)phenyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(/C=N/Nc2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3N2O4/c16-15(17,18)24-13-4-2-1-3-11(13)20-19-8-10-7-9(14(22)23)5-6-12(10)21/h1-8,20-21H,(H,22,23)/b19-8+ |
| InChIKey | FKIZPYOIVNZWHX-UFWORHAWSA-N |
| XLogP | 3.43 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|