C15H13ClN2O3 — CID 135433508
3-[(E)-[(3-chloro-2-methylphenyl)hydrazinylidene]methyl]-4-hydroxybenzoic acid (PubChem CID 135433508) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 3-[(E)-[(3-chloro-2-methylphenyl)hydrazinylidene]methyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[(E)-[(3-chloro-2-methylphenyl)hydrazinylidene]methyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135433508 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[(E)-[(3-chloro-2-methylphenyl)hydrazinylidene]methyl]-4-hydroxybenzoic acid |
| SMILES | Cc1c(Cl)cccc1N/N=C/c1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C15H13ClN2O3/c1-9-12(16)3-2-4-13(9)18-17-8-11-7-10(15(20)21)5-6-14(11)19/h2-8,18-19H,1H3,(H,20,21)/b17-8+ |
| InChIKey | SHWMJDUIYQLQBT-CAOOACKPSA-N |
| XLogP | 3.50 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|