C18H12FN5O7 — CID 135434331
2-[3-[(4-fluoro-3-nitrophenyl)carbamoylamino]phenyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 135434331) has the molecular formula C18H12FN5O7 and a molecular weight of 429.32 g/mol. Its IUPAC name is 2-[3-[(4-fluoro-3-nitrophenyl)carbamoylamino]phenyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-[3-[(4-fluoro-3-nitrophenyl)carbamoylamino]phenyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135434331 |
| Molecular Formula | C18H12FN5O7 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[3-[(4-fluoro-3-nitrophenyl)carbamoylamino]phenyl]-5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(Nc1cccc(-c2nc(C(=O)O)c(O)c(=O)[nH]2)c1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12FN5O7/c19-11-5-4-10(7-12(11)24(30)31)21-18(29)20-9-3-1-2-8(6-9)15-22-13(17(27)28)14(25)16(26)23-15/h1-7,25H,(H,27,28)(H2,20,21,29)(H,22,23,26) |
| InChIKey | UGFNXWHACJJQLP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 187.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|