About 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol
7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol (PubChem CID 135438509) has the molecular formula C23H17NO4
and a molecular weight of 371.39 g/mol. Its IUPAC name is 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol.
Molecular Properties
| Compound Name | 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol |
| PubChem CID | 135438509 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol |
| SMILES | COc1cccc(-c2c3c(nc4ccc(O)cc24)-c2ccc(O)cc2OC3)c1 |
| InChI | InChI=1S/C23H17NO4/c1-27-16-4-2-3-13(9-16)22-18-10-14(25)6-8-20(18)24-23-17-7-5-15(26)11-21(17)28-12-19(22)23/h2-11,25-26H,12H2,1H3 |
| InChIKey | SAQPECWWGZJCNM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
The IUPAC name of 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol (CID 135438509) is 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol.
What is the SMILES notation for 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
The canonical SMILES for 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol is COc1cccc(-c2c3c(nc4ccc(O)cc24)-c2ccc(O)cc2OC3)c1.
What is the InChIKey of 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
The InChIKey is SAQPECWWGZJCNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO4/c1-27-16-4-2-3-13(9-16)22-18-10-14(25)6-8-20(18)24-23-17-7-5-15(26)11-21(17)28-12-19(22)23/h2-11,25-26H,12H2,1H3.
What are the key properties of 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol?
7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol has a molecular weight of 371.39 g/mol, XLogP of 4.88, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-methoxyphenyl)-6H-chromeno[4,3-b]quinoline-3,9-diol is sourced from PubChem (CID 135438509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).