C18H11NO3 — CID 135453199
7-ethynyl-6H-chromeno[4,3-b]quinoline-3,9-diol (PubChem CID 135453199) has the molecular formula C18H11NO3 and a molecular weight of 289.29 g/mol. Its IUPAC name is 7-ethynyl-6H-chromeno[4,3-b]quinoline-3,9-diol.
| Compound Name | 7-ethynyl-6H-chromeno[4,3-b]quinoline-3,9-diol |
|---|---|
| PubChem CID | 135453199 |
| Molecular Formula | C18H11NO3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 7-ethynyl-6H-chromeno[4,3-b]quinoline-3,9-diol |
| SMILES | C#Cc1c2c(nc3ccc(O)cc13)-c1ccc(O)cc1OC2 |
| InChI | InChI=1S/C18H11NO3/c1-2-12-14-7-10(20)4-6-16(14)19-18-13-5-3-11(21)8-17(13)22-9-15(12)18/h1,3-8,20-21H,9H2 |
| InChIKey | NFDYBNVVFHAKIV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|