C23H14F3NO3 — CID 135446024
7-[4-(trifluoromethyl)phenyl]-6H-chromeno[4,3-b]quinoline-3,9-diol (PubChem CID 135446024) has the molecular formula C23H14F3NO3 and a molecular weight of 409.36 g/mol. Its IUPAC name is 7-[4-(trifluoromethyl)phenyl]-6H-chromeno[4,3-b]quinoline-3,9-diol.
| Compound Name | 7-[4-(trifluoromethyl)phenyl]-6H-chromeno[4,3-b]quinoline-3,9-diol |
|---|---|
| PubChem CID | 135446024 |
| Molecular Formula | C23H14F3NO3 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 7-[4-(trifluoromethyl)phenyl]-6H-chromeno[4,3-b]quinoline-3,9-diol |
| SMILES | Oc1ccc2c(c1)OCc1c-2nc2ccc(O)cc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H14F3NO3/c24-23(25,26)13-3-1-12(2-4-13)21-17-9-14(28)6-8-19(17)27-22-16-7-5-15(29)10-20(16)30-11-18(21)22/h1-10,28-29H,11H2 |
| InChIKey | JAWNBJUVLYLZIH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |