About 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol
7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol (PubChem CID 135466468) has the molecular formula C16H10ClNO3
and a molecular weight of 299.71 g/mol. Its IUPAC name is 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol.
Molecular Properties
| Compound Name | 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol |
| PubChem CID | 135466468 |
| Molecular Formula | C16H10ClNO3 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol |
| SMILES | Oc1ccc2c(c1)OCc1c-2nc2ccc(O)cc2c1Cl |
| InChI | InChI=1S/C16H10ClNO3/c17-15-11-5-8(19)2-4-13(11)18-16-10-3-1-9(20)6-14(10)21-7-12(15)16/h1-6,19-20H,7H2 |
| InChIKey | RYBHKLZSHRZGQK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol?
The IUPAC name of 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol (CID 135466468) is 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol.
What is the SMILES notation for 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol?
The canonical SMILES for 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol is Oc1ccc2c(c1)OCc1c-2nc2ccc(O)cc2c1Cl.
What is the InChIKey of 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol?
The InChIKey is RYBHKLZSHRZGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClNO3/c17-15-11-5-8(19)2-4-13(11)18-16-10-3-1-9(20)6-14(10)21-7-12(15)16/h1-6,19-20H,7H2.
What are the key properties of 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol?
7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol has a molecular weight of 299.71 g/mol, XLogP of 3.86, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6H-chromeno[4,3-b]quinoline-3,9-diol is sourced from PubChem (CID 135466468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).