C22H18N2O2S — CID 135442848
N-[(E)-2-benzoyl-3-cyclohexa-1,3-dien-1-yl-3-hydroxyprop-2-enylidene]pyridine-4-carbothioamide (PubChem CID 135442848) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[(E)-2-benzoyl-3-cyclohexa-1,3-dien-1-yl-3-hydroxyprop-2-enylidene]pyridine-4-carbothioamide.
| Compound Name | N-[(E)-2-benzoyl-3-cyclohexa-1,3-dien-1-yl-3-hydroxyprop-2-enylidene]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 135442848 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[(E)-2-benzoyl-3-cyclohexa-1,3-dien-1-yl-3-hydroxyprop-2-enylidene]pyridine-4-carbothioamide |
| SMILES | O=C(C(/C=N/C(=S)c1ccncc1)=C(/O)C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O2S/c25-20(16-7-3-1-4-8-16)19(21(26)17-9-5-2-6-10-17)15-24-22(27)18-11-13-23-14-12-18/h1-5,7-9,11-15,26H,6,10H2/b21-19+,24-15+ |
| InChIKey | GLCFAZAAKSNSHS-LHPHPUGJSA-N |
| XLogP | 4.80 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|