C9H12N4O2S — CID 135443619
1-[(E)-(5-hydroxy-2-pyridinyl)methylideneamino]-3-(methoxymethyl)thiourea (PubChem CID 135443619) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-[(E)-(5-hydroxy-2-pyridinyl)methylideneamino]-3-(methoxymethyl)thiourea.
| Compound Name | 1-[(E)-(5-hydroxy-2-pyridinyl)methylideneamino]-3-(methoxymethyl)thiourea |
|---|---|
| PubChem CID | 135443619 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[(E)-(5-hydroxy-2-pyridinyl)methylideneamino]-3-(methoxymethyl)thiourea |
| SMILES | COCNC(=S)N/N=C/c1ccc(O)cn1 |
| InChI | InChI=1S/C9H12N4O2S/c1-15-6-11-9(16)13-12-4-7-2-3-8(14)5-10-7/h2-5,14H,6H2,1H3,(H2,11,13,16)/b12-4+ |
| InChIKey | PLRWTPCVVPOLHK-UUILKARUSA-N |
| XLogP | 0.19 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|