C11H15N5O2S — CID 3329372
1-[(5-hydroxy-2-pyridinyl)methylideneamino]-3-morpholin-4-ylthiourea (PubChem CID 3329372) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 1-[(5-hydroxy-2-pyridinyl)methylideneamino]-3-morpholin-4-ylthiourea.
| Compound Name | 1-[(5-hydroxy-2-pyridinyl)methylideneamino]-3-morpholin-4-ylthiourea |
|---|---|
| PubChem CID | 3329372 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-[(5-hydroxy-2-pyridinyl)methylideneamino]-3-morpholin-4-ylthiourea |
| SMILES | Oc1ccc(C=NNC(=S)NN2CCOCC2)nc1 |
| InChI | InChI=1S/C11H15N5O2S/c17-10-2-1-9(12-8-10)7-13-14-11(19)15-16-3-5-18-6-4-16/h1-2,7-8,17H,3-6H2,(H2,14,15,19) |
| InChIKey | INPDHJHDGYSNOK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|