C18H13F3N4O4S — CID 135444482
ethyl 6-oxo-2-[[4-oxo-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]-1H-pyrimidine-5-carboxylate (PubChem CID 135444482) has the molecular formula C18H13F3N4O4S and a molecular weight of 438.39 g/mol. Its IUPAC name is ethyl 6-oxo-2-[[4-oxo-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-oxo-2-[[4-oxo-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135444482 |
| Molecular Formula | C18H13F3N4O4S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | ethyl 6-oxo-2-[[4-oxo-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-2-ylidene]amino]-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N=C2NC(=O)C(=Cc3ccccc3C(F)(F)F)S2)[nH]c1=O |
| InChI | InChI=1S/C18H13F3N4O4S/c1-2-29-15(28)10-8-22-16(23-13(10)26)25-17-24-14(27)12(30-17)7-9-5-3-4-6-11(9)18(19,20)21/h3-8H,2H2,1H3,(H2,22,23,24,25,26,27) |
| InChIKey | OUNNAKUSOKTMMN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|