C14H10ClFN2O3S3 — CID 135447057
N-(3-chloro-4-fluorophenyl)-4-hydroxy-1-methyl-2,2-dioxothieno[3,2-c]thiazine-3-carbothioamide (PubChem CID 135447057) has the molecular formula C14H10ClFN2O3S3 and a molecular weight of 404.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-hydroxy-1-methyl-2,2-dioxothieno[3,2-c]thiazine-3-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-hydroxy-1-methyl-2,2-dioxothieno[3,2-c]thiazine-3-carbothioamide |
|---|---|
| PubChem CID | 135447057 |
| Molecular Formula | C14H10ClFN2O3S3 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-hydroxy-1-methyl-2,2-dioxothieno[3,2-c]thiazine-3-carbothioamide |
| SMILES | CN1c2ccsc2C(O)=C(C(=S)Nc2ccc(F)c(Cl)c2)S1(=O)=O |
| InChI | InChI=1S/C14H10ClFN2O3S3/c1-18-10-4-5-23-12(10)11(19)13(24(18,20)21)14(22)17-7-2-3-9(16)8(15)6-7/h2-6,19H,1H3,(H,17,22) |
| InChIKey | XSLYZNNPNYMZND-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|