C36H31FN2O3S — CID 135448051
2-(4-fluorophenyl)imino-6-hexyl-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-7-ol (PubChem CID 135448051) has the molecular formula C36H31FN2O3S and a molecular weight of 590.72 g/mol. Its IUPAC name is 2-(4-fluorophenyl)imino-6-hexyl-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-7-ol.
| Compound Name | 2-(4-fluorophenyl)imino-6-hexyl-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-7-ol |
|---|---|
| PubChem CID | 135448051 |
| Molecular Formula | C36H31FN2O3S |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-(4-fluorophenyl)imino-6-hexyl-3-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]chromen-7-ol |
| SMILES | CCCCCCc1cc2cc(-c3nc(-c4ccc(Oc5ccccc5)cc4)cs3)/c(=N/c3ccc(F)cc3)oc2cc1O |
| InChI | InChI=1S/C36H31FN2O3S/c1-2-3-4-6-9-25-20-26-21-31(35(42-34(26)22-33(25)40)38-28-16-14-27(37)15-17-28)36-39-32(23-43-36)24-12-18-30(19-13-24)41-29-10-7-5-8-11-29/h5,7-8,10-23,40H,2-4,6,9H2,1H3/b38-35- |
| InChIKey | SJDKUOIVCUOHHG-DIGXQUICSA-N |
| XLogP | 10.22 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|