C19H19NO4S — CID 159796294
2,4-bis(2,4-dimethoxyphenyl)-1,3-thiazole (PubChem CID 159796294) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2,4-bis(2,4-dimethoxyphenyl)-1,3-thiazole.
| Compound Name | 2,4-bis(2,4-dimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 159796294 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2,4-bis(2,4-dimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(-c3ccc(OC)cc3OC)n2)c(OC)c1 |
| InChI | InChI=1S/C19H19NO4S/c1-21-12-5-7-14(17(9-12)23-3)16-11-25-19(20-16)15-8-6-13(22-2)10-18(15)24-4/h5-11H,1-4H3 |
| InChIKey | YXHUKYMJGBZBNB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |